C23H21N3O5 — CID 24800777
4-[2-(3,4,5-trimethoxyanilino)-1,3-benzoxazol-7-yl]benzamide (PubChem CID 24800777) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is 4-[2-(3,4,5-trimethoxyanilino)-1,3-benzoxazol-7-yl]benzamide.
| Compound Name | 4-[2-(3,4,5-trimethoxyanilino)-1,3-benzoxazol-7-yl]benzamide |
|---|---|
| PubChem CID | 24800777 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[2-(3,4,5-trimethoxyanilino)-1,3-benzoxazol-7-yl]benzamide |
| SMILES | COc1cc(Nc2nc3cccc(-c4ccc(C(N)=O)cc4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O5/c1-28-18-11-15(12-19(29-2)21(18)30-3)25-23-26-17-6-4-5-16(20(17)31-23)13-7-9-14(10-8-13)22(24)27/h4-12H,1-3H3,(H2,24,27)(H,25,26) |
| InChIKey | RPLKUFKLZRTRTQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |