C22H19N3O6 — CID 24801815
7-(3-nitrophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24801815) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is 7-(3-nitrophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-(3-nitrophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24801815 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 7-(3-nitrophenyl)-N-(3,4,5-trimethoxyphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1cc(Nc2nc3cccc(-c4cccc([N+](=O)[O-])c4)c3o2)cc(OC)c1OC |
| InChI | InChI=1S/C22H19N3O6/c1-28-18-11-14(12-19(29-2)21(18)30-3)23-22-24-17-9-5-8-16(20(17)31-22)13-6-4-7-15(10-13)25(26)27/h4-12H,1-3H3,(H,23,24) |
| InChIKey | SPCOPMGBQSRBOB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|