C29H30F2N4O3 — CID 59144244
7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-(3-methyl-4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine (PubChem CID 59144244) has the molecular formula C29H30F2N4O3 and a molecular weight of 520.58 g/mol. Its IUPAC name is 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-(3-methyl-4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-(3-methyl-4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 59144244 |
| Molecular Formula | C29H30F2N4O3 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-(3-methyl-4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(Nc2nc3cccc(-c4cc(F)c(CN5CCOCC5)c(F)c4)c3o2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C29H30F2N4O3/c1-19-15-21(5-6-27(19)35-9-13-37-14-10-35)32-29-33-26-4-2-3-22(28(26)38-29)20-16-24(30)23(25(31)17-20)18-34-7-11-36-12-8-34/h2-6,15-17H,7-14,18H2,1H3,(H,32,33) |
| InChIKey | LFIPYLTZWVXODV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|