C31H33F2N5O3 — CID 59144249
[4-[2-[4-(4-ethylpiperazin-1-yl)-3-methylanilino]-1,3-benzoxazol-7-yl]-2,6-difluorophenyl]-morpholin-4-ylmethanone (PubChem CID 59144249) has the molecular formula C31H33F2N5O3 and a molecular weight of 561.63 g/mol. Its IUPAC name is [4-[2-[4-(4-ethylpiperazin-1-yl)-3-methylanilino]-1,3-benzoxazol-7-yl]-2,6-difluorophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-[4-(4-ethylpiperazin-1-yl)-3-methylanilino]-1,3-benzoxazol-7-yl]-2,6-difluorophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59144249 |
| Molecular Formula | C31H33F2N5O3 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | [4-[2-[4-(4-ethylpiperazin-1-yl)-3-methylanilino]-1,3-benzoxazol-7-yl]-2,6-difluorophenyl]-morpholin-4-ylmethanone |
| SMILES | CCN1CCN(c2ccc(Nc3nc4cccc(-c5cc(F)c(C(=O)N6CCOCC6)c(F)c5)c4o3)cc2C)CC1 |
| InChI | InChI=1S/C31H33F2N5O3/c1-3-36-9-11-37(12-10-36)27-8-7-22(17-20(27)2)34-31-35-26-6-4-5-23(29(26)41-31)21-18-24(32)28(25(33)19-21)30(39)38-13-15-40-16-14-38/h4-8,17-19H,3,9-16H2,1-2H3,(H,34,35) |
| InChIKey | GIAHBIDISHJFLI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|