C31H31FN6O3 — CID 143641461
5-[[7-[3-fluoro-4-(3-morpholin-4-yloxiran-2-yl)phenyl]-1,3-benzoxazol-2-yl]amino]-2-(4-methylpiperazin-1-yl)benzonitrile (PubChem CID 143641461) has the molecular formula C31H31FN6O3 and a molecular weight of 554.63 g/mol. Its IUPAC name is 5-[[7-[3-fluoro-4-(3-morpholin-4-yloxiran-2-yl)phenyl]-1,3-benzoxazol-2-yl]amino]-2-(4-methylpiperazin-1-yl)benzonitrile.
| Compound Name | 5-[[7-[3-fluoro-4-(3-morpholin-4-yloxiran-2-yl)phenyl]-1,3-benzoxazol-2-yl]amino]-2-(4-methylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 143641461 |
| Molecular Formula | C31H31FN6O3 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 5-[[7-[3-fluoro-4-(3-morpholin-4-yloxiran-2-yl)phenyl]-1,3-benzoxazol-2-yl]amino]-2-(4-methylpiperazin-1-yl)benzonitrile |
| SMILES | CN1CCN(c2ccc(Nc3nc4cccc(-c5ccc(C6OC6N6CCOCC6)c(F)c5)c4o3)cc2C#N)CC1 |
| InChI | InChI=1S/C31H31FN6O3/c1-36-9-11-37(12-10-36)27-8-6-22(17-21(27)19-33)34-31-35-26-4-2-3-23(28(26)41-31)20-5-7-24(25(32)18-20)29-30(40-29)38-13-15-39-16-14-38/h2-8,17-18,29-30H,9-16H2,1H3,(H,34,35) |
| InChIKey | BAAJHFGWIRPITC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|