C30H34N4O3S — CID 67457233
N-[4-(4-cyclopropylpiperazin-1-yl)-3-methylphenyl]-7-(2,3-dimethyl-4-methylsulfonylphenyl)-1,3-benzoxazol-2-amine (PubChem CID 67457233) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[4-(4-cyclopropylpiperazin-1-yl)-3-methylphenyl]-7-(2,3-dimethyl-4-methylsulfonylphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-[4-(4-cyclopropylpiperazin-1-yl)-3-methylphenyl]-7-(2,3-dimethyl-4-methylsulfonylphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 67457233 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[4-(4-cyclopropylpiperazin-1-yl)-3-methylphenyl]-7-(2,3-dimethyl-4-methylsulfonylphenyl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(Nc2nc3cccc(-c4ccc(S(C)(=O)=O)c(C)c4C)c3o2)ccc1N1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C30H34N4O3S/c1-19-18-22(8-12-27(19)34-16-14-33(15-17-34)23-9-10-23)31-30-32-26-7-5-6-25(29(26)37-30)24-11-13-28(38(4,35)36)21(3)20(24)2/h5-8,11-13,18,23H,9-10,14-17H2,1-4H3,(H,31,32) |
| InChIKey | PVPCWNMKBVBDJG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|