C22H21N5O2 — CID 24801647
7-(3-aminophenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzoxazol-2-amine (PubChem CID 24801647) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 7-(3-aminophenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-(3-aminophenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24801647 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 7-(3-aminophenyl)-N-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzoxazol-2-amine |
| SMILES | Nc1cccc(-c2cccc3nc(Nc4ccc(N5CCOCC5)nc4)oc23)c1 |
| InChI | InChI=1S/C22H21N5O2/c23-16-4-1-3-15(13-16)18-5-2-6-19-21(18)29-22(26-19)25-17-7-8-20(24-14-17)27-9-11-28-12-10-27/h1-8,13-14H,9-12,23H2,(H,25,26) |
| InChIKey | PWYCTUYWQSVOTG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|