C32H35N5O3 — CID 59144269
[4-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1,3-benzoxazol-7-yl]-2-methylphenyl]-morpholin-4-ylmethanone (PubChem CID 59144269) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is [4-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1,3-benzoxazol-7-yl]-2-methylphenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1,3-benzoxazol-7-yl]-2-methylphenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59144269 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [4-[2-[4-(4-cyclopropylpiperazin-1-yl)anilino]-1,3-benzoxazol-7-yl]-2-methylphenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(-c2cccc3nc(Nc4ccc(N5CCN(C6CC6)CC5)cc4)oc23)ccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C32H35N5O3/c1-22-21-23(5-12-27(22)31(38)37-17-19-39-20-18-37)28-3-2-4-29-30(28)40-32(34-29)33-24-6-8-25(9-7-24)35-13-15-36(16-14-35)26-10-11-26/h2-9,12,21,26H,10-11,13-20H2,1H3,(H,33,34) |
| InChIKey | LMUAGWHSPUFRRA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|