C30H30N4O3 — CID 59392747
[2-methyl-4-[3-(4-morpholin-4-ylphenyl)quinoxalin-5-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 59392747) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is [2-methyl-4-[3-(4-morpholin-4-ylphenyl)quinoxalin-5-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2-methyl-4-[3-(4-morpholin-4-ylphenyl)quinoxalin-5-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59392747 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [2-methyl-4-[3-(4-morpholin-4-ylphenyl)quinoxalin-5-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(-c2cccc3ncc(-c4ccc(N5CCOCC5)cc4)nc23)ccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C30H30N4O3/c1-21-19-23(7-10-25(21)30(35)34-13-17-37-18-14-34)26-3-2-4-27-29(26)32-28(20-31-27)22-5-8-24(9-6-22)33-11-15-36-16-12-33/h2-10,19-20H,11-18H2,1H3 |
| InChIKey | CPFIGYZYOOQUQD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |