C12H19F3O — CID 15651906
[(Z)-3-ethoxy-4,4,4-trifluorobut-2-enyl]cyclohexane (PubChem CID 15651906) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is [(Z)-3-ethoxy-4,4,4-trifluorobut-2-enyl]cyclohexane.
| Compound Name | [(Z)-3-ethoxy-4,4,4-trifluorobut-2-enyl]cyclohexane |
|---|---|
| PubChem CID | 15651906 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(Z)-3-ethoxy-4,4,4-trifluorobut-2-enyl]cyclohexane |
| SMILES | CCO/C(=C\CC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O/c1-2-16-11(12(13,14)15)9-8-10-6-4-3-5-7-10/h9-10H,2-8H2,1H3/b11-9- |
| InChIKey | QEKNKLHOLDRWFT-LUAWRHEFSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|