C26H30N8O2 — CID 156519337
6-(2-methoxyethoxy)-4-[(2E,4Z)-5-(methylideneamino)-5-[4-(pyrimidin-2-ylmethyl)piperazin-1-yl]penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine-3-carbonitrile (PubChem CID 156519337) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 6-(2-methoxyethoxy)-4-[(2E,4Z)-5-(methylideneamino)-5-[4-(pyrimidin-2-ylmethyl)piperazin-1-yl]penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine-3-carbonitrile.
| Compound Name | 6-(2-methoxyethoxy)-4-[(2E,4Z)-5-(methylideneamino)-5-[4-(pyrimidin-2-ylmethyl)piperazin-1-yl]penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 156519337 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 6-(2-methoxyethoxy)-4-[(2E,4Z)-5-(methylideneamino)-5-[4-(pyrimidin-2-ylmethyl)piperazin-1-yl]penta-2,4-dien-2-yl]pyrazolo[1,5-a]pyridine-3-carbonitrile |
| SMILES | C=N/C(=C\C=C(/C)c1cc(OCCOC)cn2ncc(C#N)c12)N1CCN(Cc2ncccn2)CC1 |
| InChI | InChI=1S/C26H30N8O2/c1-20(23-15-22(36-14-13-35-3)18-34-26(23)21(16-27)17-31-34)5-6-25(28-2)33-11-9-32(10-12-33)19-24-29-7-4-8-30-24/h4-8,15,17-18H,2,9-14,19H2,1,3H3/b20-5+,25-6+ |
| InChIKey | SUYBMNFDRDXROK-TYQNKIHMSA-N |
| XLogP | 2.78 |
| TPSA | 104.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|