C25H22ClF3N4O2S — CID 156520772
7-chloro-8-[5-(difluoromethyl)-2-fluorophenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 156520772) has the molecular formula C25H22ClF3N4O2S and a molecular weight of 534.99 g/mol. Its IUPAC name is 7-chloro-8-[5-(difluoromethyl)-2-fluorophenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 7-chloro-8-[5-(difluoromethyl)-2-fluorophenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 156520772 |
| Molecular Formula | C25H22ClF3N4O2S |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 7-chloro-8-[5-(difluoromethyl)-2-fluorophenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5cc(C(F)F)ccc5F)c(Cl)cc24)SCC3)[C@@H](C)C1 |
| InChI | InChI=1S/C25H22ClF3N4O2S/c1-3-19(34)31-6-7-32(13(2)12-31)24-16-11-17(26)20(15-10-14(23(28)29)4-5-18(15)27)22-21(16)33(8-9-36-22)25(35)30-24/h3-5,10-11,13,23H,1,6-9,12H2,2H3/t13-/m0/s1 |
| InChIKey | RLYFKXSCLFQZJB-ZDUSSCGKSA-N |
| XLogP | 5.12 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|