C26H24ClF3N4O2S — CID 164739993
7-chloro-8-(2,4-difluorophenyl)-4-[(2S)-4-[(E)-4-fluoropent-2-enoyl]-2-methylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 164739993) has the molecular formula C26H24ClF3N4O2S and a molecular weight of 549.02 g/mol. Its IUPAC name is 7-chloro-8-(2,4-difluorophenyl)-4-[(2S)-4-[(E)-4-fluoropent-2-enoyl]-2-methylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(2S)-4-[(E)-4-fluoropent-2-enoyl]-2-methylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 164739993 |
| Molecular Formula | C26H24ClF3N4O2S |
| Molecular Weight | 549.02 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 7-chloro-8-(2,4-difluorophenyl)-4-[(2S)-4-[(E)-4-fluoropent-2-enoyl]-2-methylpiperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | CC(F)/C=C/C(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(Cl)cc24)SCC3)[C@@H](C)C1 |
| InChI | InChI=1S/C26H24ClF3N4O2S/c1-14(28)3-6-21(35)32-7-8-33(15(2)13-32)25-18-12-19(27)22(17-5-4-16(29)11-20(17)30)24-23(18)34(9-10-37-24)26(36)31-25/h3-6,11-12,14-15H,7-10,13H2,1-2H3/b6-3+/t14?,15-/m0/s1 |
| InChIKey | SJGQWKJICZOZLL-QSJDJAMISA-N |
| XLogP | 5.05 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.02 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|