C27H25F3N4O2 — CID 156523552
N-[1-[2-cyano-4-(trifluoromethyl)phenyl]-4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]formamide (PubChem CID 156523552) has the molecular formula C27H25F3N4O2 and a molecular weight of 494.52 g/mol. Its IUPAC name is N-[1-[2-cyano-4-(trifluoromethyl)phenyl]-4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]formamide.
| Compound Name | N-[1-[2-cyano-4-(trifluoromethyl)phenyl]-4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 156523552 |
| Molecular Formula | C27H25F3N4O2 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[1-[2-cyano-4-(trifluoromethyl)phenyl]-4-[4-(2-ethoxy-3-pyridinyl)phenyl]piperidin-4-yl]formamide |
| SMILES | CCOc1ncccc1-c1ccc(C2(NC=O)CCN(c3ccc(C(F)(F)F)cc3C#N)CC2)cc1 |
| InChI | InChI=1S/C27H25F3N4O2/c1-2-36-25-23(4-3-13-32-25)19-5-7-21(8-6-19)26(33-18-35)11-14-34(15-12-26)24-10-9-22(27(28,29)30)16-20(24)17-31/h3-10,13,16,18H,2,11-12,14-15H2,1H3,(H,33,35) |
| InChIKey | PBGJEMHJNGMWAS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|