C27H40N4O3 — CID 170576680
tert-butyl 4-[2-cyano-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate;ethane (PubChem CID 170576680) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is tert-butyl 4-[2-cyano-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[2-cyano-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 170576680 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | tert-butyl 4-[2-cyano-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC.CCOc1ncccc1-c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(C#N)c1 |
| InChI | InChI=1S/C23H28N4O3.2C2H6/c1-5-29-21-19(7-6-10-25-21)17-8-9-20(18(15-17)16-24)26-11-13-27(14-12-26)22(28)30-23(2,3)4;2*1-2/h6-10,15H,5,11-14H2,1-4H3;2*1-2H3 |
| InChIKey | JRVOQAUZGAOLHL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |