C23H32N4O3 — CID 170576656
tert-butyl 4-[2-(aminomethyl)-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate (PubChem CID 170576656) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(aminomethyl)-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(aminomethyl)-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170576656 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl 4-[2-(aminomethyl)-4-(2-ethoxy-3-pyridinyl)phenyl]piperazine-1-carboxylate |
| SMILES | CCOc1ncccc1-c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(CN)c1 |
| InChI | InChI=1S/C23H32N4O3/c1-5-29-21-19(7-6-10-25-21)17-8-9-20(18(15-17)16-24)26-11-13-27(14-12-26)22(28)30-23(2,3)4/h6-10,15H,5,11-14,16,24H2,1-4H3 |
| InChIKey | YBZVIYSMOFLHBS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |