C14H17N5O4S — CID 156524612
N-(3-amino-3-oxopropyl)-2-[(3-methyl-5-nitro-1,2-dihydroimidazol-4-yl)sulfanyl]benzamide (PubChem CID 156524612) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-2-[(3-methyl-5-nitro-1,2-dihydroimidazol-4-yl)sulfanyl]benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-2-[(3-methyl-5-nitro-1,2-dihydroimidazol-4-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 156524612 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-2-[(3-methyl-5-nitro-1,2-dihydroimidazol-4-yl)sulfanyl]benzamide |
| SMILES | CN1CNC([N+](=O)[O-])=C1Sc1ccccc1C(=O)NCCC(N)=O |
| InChI | InChI=1S/C14H17N5O4S/c1-18-8-17-12(19(22)23)14(18)24-10-5-3-2-4-9(10)13(21)16-7-6-11(15)20/h2-5,17H,6-8H2,1H3,(H2,15,20)(H,16,21) |
| InChIKey | MVWPUDGTRRNIQY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|