C22H20F3N5O2 — CID 156525998
[6-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3-[2-(2,4,5-trifluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol (PubChem CID 156525998) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is [6-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3-[2-(2,4,5-trifluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol.
| Compound Name | [6-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3-[2-(2,4,5-trifluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
|---|---|
| PubChem CID | 156525998 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [6-(2-oxa-8-azaspiro[4.5]decan-8-yl)-3-[2-(2,4,5-trifluorophenyl)ethynyl]-2H-pyrazolo[3,4-b]pyrazin-5-yl]methanol |
| SMILES | OCc1nc2c(C#Cc3cc(F)c(F)cc3F)[nH]nc2nc1N1CCC2(CCOC2)CC1 |
| InChI | InChI=1S/C22H20F3N5O2/c23-14-10-16(25)15(24)9-13(14)1-2-17-19-20(29-28-17)27-21(18(11-31)26-19)30-6-3-22(4-7-30)5-8-32-12-22/h9-10,31H,3-8,11-12H2,(H,27,28,29) |
| InChIKey | UJDJUJKTJDPQNF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|