C23H26F4N6 — CID 156526776
(1S)-N'-[7-(6-fluoro-1,4-diazepan-1-yl)-4-methylphthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine (PubChem CID 156526776) has the molecular formula C23H26F4N6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (1S)-N'-[7-(6-fluoro-1,4-diazepan-1-yl)-4-methylphthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine.
| Compound Name | (1S)-N'-[7-(6-fluoro-1,4-diazepan-1-yl)-4-methylphthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
|---|---|
| PubChem CID | 156526776 |
| Molecular Formula | C23H26F4N6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (1S)-N'-[7-(6-fluoro-1,4-diazepan-1-yl)-4-methylphthalazin-1-yl]-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
| SMILES | Cc1c([C@@H](N)Nc2nnc(C)c3ccc(N4CCNCC(F)C4)cc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C23H26F4N6/c1-13-17(4-3-5-20(13)23(25,26)27)21(28)30-22-19-10-16(6-7-18(19)14(2)31-32-22)33-9-8-29-11-15(24)12-33/h3-7,10,15,21,29H,8-9,11-12,28H2,1-2H3,(H,30,32)/t15?,21-/m0/s1 |
| InChIKey | MNYOGSKYDDFVAK-FXMQYSIJSA-N |
| XLogP | 4.08 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|