C22H25F3N6 — CID 156526771
(1S)-N'-(4-methyl-7-piperazin-1-ylphthalazin-1-yl)-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine (PubChem CID 156526771) has the molecular formula C22H25F3N6 and a molecular weight of 430.48 g/mol. Its IUPAC name is (1S)-N'-(4-methyl-7-piperazin-1-ylphthalazin-1-yl)-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine.
| Compound Name | (1S)-N'-(4-methyl-7-piperazin-1-ylphthalazin-1-yl)-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
|---|---|
| PubChem CID | 156526771 |
| Molecular Formula | C22H25F3N6 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | (1S)-N'-(4-methyl-7-piperazin-1-ylphthalazin-1-yl)-1-[2-methyl-3-(trifluoromethyl)phenyl]methanediamine |
| SMILES | Cc1c([C@@H](N)Nc2nnc(C)c3ccc(N4CCNCC4)cc23)cccc1C(F)(F)F |
| InChI | InChI=1S/C22H25F3N6/c1-13-16(4-3-5-19(13)22(23,24)25)20(26)28-21-18-12-15(31-10-8-27-9-11-31)6-7-17(18)14(2)29-30-21/h3-7,12,20,27H,8-11,26H2,1-2H3,(H,28,30)/t20-/m0/s1 |
| InChIKey | FKVSUNDQOXGTOB-FQEVSTJZSA-N |
| XLogP | 3.74 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|