C21H24ClN5O — CID 156526600
(1S)-1-(2-chloro-3-methylphenyl)-N'-(4-methyl-7-morpholin-4-ylphthalazin-1-yl)methanediamine (PubChem CID 156526600) has the molecular formula C21H24ClN5O and a molecular weight of 397.91 g/mol. Its IUPAC name is (1S)-1-(2-chloro-3-methylphenyl)-N'-(4-methyl-7-morpholin-4-ylphthalazin-1-yl)methanediamine.
| Compound Name | (1S)-1-(2-chloro-3-methylphenyl)-N'-(4-methyl-7-morpholin-4-ylphthalazin-1-yl)methanediamine |
|---|---|
| PubChem CID | 156526600 |
| Molecular Formula | C21H24ClN5O |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1S)-1-(2-chloro-3-methylphenyl)-N'-(4-methyl-7-morpholin-4-ylphthalazin-1-yl)methanediamine |
| SMILES | Cc1cccc([C@@H](N)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)c1Cl |
| InChI | InChI=1S/C21H24ClN5O/c1-13-4-3-5-17(19(13)22)20(23)24-21-18-12-15(27-8-10-28-11-9-27)6-7-16(18)14(2)25-26-21/h3-7,12,20H,8-11,23H2,1-2H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | NCJGEJLLISKWPP-FQEVSTJZSA-N |
| XLogP | 3.81 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|