C23H24F3N6O+ — CID 160814004
4-methyl-3-[(1R)-1-[(4-methyl-7-morpholin-4-ylphthalazin-1-yl)amino]ethyl]-5-(trifluoromethyl)benzenediazonium (PubChem CID 160814004) has the molecular formula C23H24F3N6O+ and a molecular weight of 457.48 g/mol. Its IUPAC name is 4-methyl-3-[(1R)-1-[(4-methyl-7-morpholin-4-ylphthalazin-1-yl)amino]ethyl]-5-(trifluoromethyl)benzenediazonium.
| Compound Name | 4-methyl-3-[(1R)-1-[(4-methyl-7-morpholin-4-ylphthalazin-1-yl)amino]ethyl]-5-(trifluoromethyl)benzenediazonium |
|---|---|
| PubChem CID | 160814004 |
| Molecular Formula | C23H24F3N6O+ |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-methyl-3-[(1R)-1-[(4-methyl-7-morpholin-4-ylphthalazin-1-yl)amino]ethyl]-5-(trifluoromethyl)benzenediazonium |
| SMILES | Cc1c([C@@H](C)Nc2nnc(C)c3ccc(N4CCOCC4)cc23)cc([N+]#N)cc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3N6O/c1-13-19(10-16(29-27)11-21(13)23(24,25)26)14(2)28-22-20-12-17(32-6-8-33-9-7-32)4-5-18(20)15(3)30-31-22/h4-5,10-12,14H,6-9H2,1-3H3,(H,28,31)/q+1/t14-/m1/s1 |
| InChIKey | IBJGWZTWOQVPAJ-CQSZACIVSA-N |
| XLogP | 5.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|