C26H29N9 — CID 156526631
3-[(S)-amino-[[4-methyl-7-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]phthalazin-1-yl]amino]methyl]-2-methylbenzonitrile (PubChem CID 156526631) has the molecular formula C26H29N9 and a molecular weight of 467.58 g/mol. Its IUPAC name is 3-[(S)-amino-[[4-methyl-7-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]phthalazin-1-yl]amino]methyl]-2-methylbenzonitrile.
| Compound Name | 3-[(S)-amino-[[4-methyl-7-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]phthalazin-1-yl]amino]methyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 156526631 |
| Molecular Formula | C26H29N9 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-[(S)-amino-[[4-methyl-7-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]phthalazin-1-yl]amino]methyl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1[C@@H](N)Nc1nnc(C)c2ccc(N3CCN(c4cnn(C)c4)CC3)cc12 |
| InChI | InChI=1S/C26H29N9/c1-17-19(14-27)5-4-6-22(17)25(28)30-26-24-13-20(7-8-23(24)18(2)31-32-26)34-9-11-35(12-10-34)21-15-29-33(3)16-21/h4-8,13,15-16,25H,9-12,28H2,1-3H3,(H,30,32)/t25-/m0/s1 |
| InChIKey | SWMYUKRQPAADFZ-VWLOTQADSA-N |
| XLogP | 3.25 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|