C25H28FN7O — CID 156526761
3-[(S)-[[7-[(9aR)-3,4,6,8,9,9a-hexahydro-1H-pyrazino[1,2-c][1,3]oxazin-2-yl]-5-fluoro-4-methylphthalazin-1-yl]amino]-aminomethyl]-2-methylbenzonitrile (PubChem CID 156526761) has the molecular formula C25H28FN7O and a molecular weight of 461.55 g/mol. Its IUPAC name is 3-[(S)-[[7-[(9aR)-3,4,6,8,9,9a-hexahydro-1H-pyrazino[1,2-c][1,3]oxazin-2-yl]-5-fluoro-4-methylphthalazin-1-yl]amino]-aminomethyl]-2-methylbenzonitrile.
| Compound Name | 3-[(S)-[[7-[(9aR)-3,4,6,8,9,9a-hexahydro-1H-pyrazino[1,2-c][1,3]oxazin-2-yl]-5-fluoro-4-methylphthalazin-1-yl]amino]-aminomethyl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 156526761 |
| Molecular Formula | C25H28FN7O |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[(S)-[[7-[(9aR)-3,4,6,8,9,9a-hexahydro-1H-pyrazino[1,2-c][1,3]oxazin-2-yl]-5-fluoro-4-methylphthalazin-1-yl]amino]-aminomethyl]-2-methylbenzonitrile |
| SMILES | Cc1c(C#N)cccc1[C@@H](N)Nc1nnc(C)c2c(F)cc(N3CCN4COCC[C@@H]4C3)cc12 |
| InChI | InChI=1S/C25H28FN7O/c1-15-17(12-27)4-3-5-20(15)24(28)29-25-21-10-19(11-22(26)23(21)16(2)30-31-25)32-7-8-33-14-34-9-6-18(33)13-32/h3-5,10-11,18,24H,6-9,13-14,28H2,1-2H3,(H,29,31)/t18-,24+/m1/s1 |
| InChIKey | IIJWTXVKJLKPRD-KOSHJBKYSA-N |
| XLogP | 3.20 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|