C22H25F2N7O — CID 156526915
(1S)-N'-[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]-1-(2,3-difluorophenyl)methanediamine (PubChem CID 156526915) has the molecular formula C22H25F2N7O and a molecular weight of 441.49 g/mol. Its IUPAC name is (1S)-N'-[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]-1-(2,3-difluorophenyl)methanediamine.
| Compound Name | (1S)-N'-[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]-1-(2,3-difluorophenyl)methanediamine |
|---|---|
| PubChem CID | 156526915 |
| Molecular Formula | C22H25F2N7O |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (1S)-N'-[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]-1-(2,3-difluorophenyl)methanediamine |
| SMILES | Cc1nnc(N[C@H](N)c2cccc(F)c2F)c2cc(N3CCN4CCOC[C@@H]4C3)ncc12 |
| InChI | InChI=1S/C22H25F2N7O/c1-13-17-10-26-19(31-6-5-30-7-8-32-12-14(30)11-31)9-16(17)22(29-28-13)27-21(25)15-3-2-4-18(23)20(15)24/h2-4,9-10,14,21H,5-8,11-12,25H2,1H3,(H,27,29)/t14-,21-/m0/s1 |
| InChIKey | TWAAQYHUHDKGOI-QKKBWIMNSA-N |
| XLogP | 2.20 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|