C24H25F2N7O — CID 156527168
3-[(1R)-1-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]ethyl]-2,5-difluorobenzonitrile (PubChem CID 156527168) has the molecular formula C24H25F2N7O and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-[(1R)-1-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]ethyl]-2,5-difluorobenzonitrile.
| Compound Name | 3-[(1R)-1-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]ethyl]-2,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 156527168 |
| Molecular Formula | C24H25F2N7O |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 3-[(1R)-1-[[7-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-4-methylpyrido[3,4-d]pyridazin-1-yl]amino]ethyl]-2,5-difluorobenzonitrile |
| SMILES | Cc1nnc(N[C@H](C)c2cc(F)cc(C#N)c2F)c2cc(N3CCN4CCOC[C@@H]4C3)ncc12 |
| InChI | InChI=1S/C24H25F2N7O/c1-14(19-8-17(25)7-16(10-27)23(19)26)29-24-20-9-22(28-11-21(20)15(2)30-31-24)33-4-3-32-5-6-34-13-18(32)12-33/h7-9,11,14,18H,3-6,12-13H2,1-2H3,(H,29,31)/t14-,18+/m1/s1 |
| InChIKey | QKRCSORFJSHJEH-KDOFPFPSSA-N |
| XLogP | 3.18 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |