C13H16N2O2 — CID 156530012
ethyl (3S,6R)-6-methyl-9,10-diazatricyclo[6.3.0.03,6]undeca-1(8),4,10-triene-11-carboxylate (PubChem CID 156530012) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is ethyl (3S,6R)-6-methyl-9,10-diazatricyclo[6.3.0.03,6]undeca-1(8),4,10-triene-11-carboxylate.
| Compound Name | ethyl (3S,6R)-6-methyl-9,10-diazatricyclo[6.3.0.03,6]undeca-1(8),4,10-triene-11-carboxylate |
|---|---|
| PubChem CID | 156530012 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | ethyl (3S,6R)-6-methyl-9,10-diazatricyclo[6.3.0.03,6]undeca-1(8),4,10-triene-11-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c2c1C[C@H]1C=C[C@@]1(C)C2 |
| InChI | InChI=1S/C13H16N2O2/c1-3-17-12(16)11-9-6-8-4-5-13(8,2)7-10(9)14-15-11/h4-5,8H,3,6-7H2,1-2H3,(H,14,15)/t8-,13+/m1/s1 |
| InChIKey | WCJUKMLIUQMVQK-OQPBUACISA-N |
| XLogP | 1.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|