C20H24IN3O3 — CID 156532995
[(3S)-4-[[2-(aminomethyl)phenyl]methyl]-3-hydroxypiperidin-1-yl]-(6-iodo-2-methoxy-3-pyridinyl)methanone (PubChem CID 156532995) has the molecular formula C20H24IN3O3 and a molecular weight of 481.33 g/mol. Its IUPAC name is [(3S)-4-[[2-(aminomethyl)phenyl]methyl]-3-hydroxypiperidin-1-yl]-(6-iodo-2-methoxy-3-pyridinyl)methanone.
| Compound Name | [(3S)-4-[[2-(aminomethyl)phenyl]methyl]-3-hydroxypiperidin-1-yl]-(6-iodo-2-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 156532995 |
| Molecular Formula | C20H24IN3O3 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [(3S)-4-[[2-(aminomethyl)phenyl]methyl]-3-hydroxypiperidin-1-yl]-(6-iodo-2-methoxy-3-pyridinyl)methanone |
| SMILES | COc1nc(I)ccc1C(=O)N1CCC(Cc2ccccc2CN)[C@H](O)C1 |
| InChI | InChI=1S/C20H24IN3O3/c1-27-19-16(6-7-18(21)23-19)20(26)24-9-8-14(17(25)12-24)10-13-4-2-3-5-15(13)11-22/h2-7,14,17,25H,8-12,22H2,1H3/t14?,17-/m1/s1 |
| InChIKey | ZBIIZFRMPFDQMZ-FBMWCMRBSA-N |
| XLogP | 2.22 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|