C14H19NO3 — CID 56887256
[(3S,4S)-3,4-dihydroxypiperidin-1-yl]-(2-ethylphenyl)methanone (PubChem CID 56887256) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-(2-ethylphenyl)methanone.
| Compound Name | [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-(2-ethylphenyl)methanone |
|---|---|
| PubChem CID | 56887256 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [(3S,4S)-3,4-dihydroxypiperidin-1-yl]-(2-ethylphenyl)methanone |
| SMILES | CCc1ccccc1C(=O)N1CC[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C14H19NO3/c1-2-10-5-3-4-6-11(10)14(18)15-8-7-12(16)13(17)9-15/h3-6,12-13,16-17H,2,7-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | AXUFOQITYGTRCM-STQMWFEESA-N |
| XLogP | 0.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |