C28H37N5O7 — CID 156533791
(4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoic acid (PubChem CID 156533791) has the molecular formula C28H37N5O7 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 156533791 |
| Molecular Formula | C28H37N5O7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-naphthalen-1-ylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@H](C(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(N)=O)C(C)C |
| InChI | InChI=1S/C28H37N5O7/c1-15(2)24(31-17(4)34)28(40)33-22(14-19-10-7-9-18-8-5-6-11-20(18)19)27(39)30-16(3)26(38)32-21(25(29)37)12-13-23(35)36/h5-11,15-16,21-22,24H,12-14H2,1-4H3,(H2,29,37)(H,30,39)(H,31,34)(H,32,38)(H,33,40)(H,35,36)/t16-,21-,22-,24-/m0/s1 |
| InChIKey | YHSLZTHOJNGFHY-HCNFCUEQSA-N |
| XLogP | 0.37 |
| TPSA | 196.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |