C24H20F5N5 — CID 156536265
N-[3-(4,4-difluoro-3,3-dimethylbut-1-ynyl)phenyl]-N-(2,2-difluoroethyl)-6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536265) has the molecular formula C24H20F5N5 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-[3-(4,4-difluoro-3,3-dimethylbut-1-ynyl)phenyl]-N-(2,2-difluoroethyl)-6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-[3-(4,4-difluoro-3,3-dimethylbut-1-ynyl)phenyl]-N-(2,2-difluoroethyl)-6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536265 |
| Molecular Formula | C24H20F5N5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-[3-(4,4-difluoro-3,3-dimethylbut-1-ynyl)phenyl]-N-(2,2-difluoroethyl)-6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | Cc1nnc2nc(N(CC(F)F)c3cccc(C#CC(C)(C)C(F)F)c3)c3c(F)cccc3n12 |
| InChI | InChI=1S/C24H20F5N5/c1-14-31-32-23-30-21(20-17(25)8-5-9-18(20)34(14)23)33(13-19(26)27)16-7-4-6-15(12-16)10-11-24(2,3)22(28)29/h4-9,12,19,22H,13H2,1-3H3 |
| InChIKey | QTGKNMNCLIQUCV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|