C23H16F7N5 — CID 156536402
N-(2,2-difluoroethyl)-6,7-difluoro-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536402) has the molecular formula C23H16F7N5 and a molecular weight of 495.40 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6,7-difluoro-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-(2,2-difluoroethyl)-6,7-difluoro-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536402 |
| Molecular Formula | C23H16F7N5 |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-6,7-difluoro-N-[3-(4,4,4-trifluoro-3,3-dimethylbut-1-ynyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | CC(C)(C#Cc1cccc(N(CC(F)F)c2nc3nncn3c3ccc(F)c(F)c23)c1)C(F)(F)F |
| InChI | InChI=1S/C23H16F7N5/c1-22(2,23(28,29)30)9-8-13-4-3-5-14(10-13)34(11-17(25)26)20-18-16(7-6-15(24)19(18)27)35-12-31-33-21(35)32-20/h3-7,10,12,17H,11H2,1-2H3 |
| InChIKey | YBKAIRHXUUGTNM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|