C23H20F7N5 — CID 156557472
N-(2,2-difluoroethyl)-7-fluoro-N-[2-fluoro-3-(4,4,4-trifluoro-3,3-dimethylbutyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156557472) has the molecular formula C23H20F7N5 and a molecular weight of 499.43 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-7-fluoro-N-[2-fluoro-3-(4,4,4-trifluoro-3,3-dimethylbutyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-(2,2-difluoroethyl)-7-fluoro-N-[2-fluoro-3-(4,4,4-trifluoro-3,3-dimethylbutyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156557472 |
| Molecular Formula | C23H20F7N5 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-(2,2-difluoroethyl)-7-fluoro-N-[2-fluoro-3-(4,4,4-trifluoro-3,3-dimethylbutyl)phenyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | CC(C)(CCc1cccc(N(CC(F)F)c2nc3nncn3c3ccc(F)cc23)c1F)C(F)(F)F |
| InChI | InChI=1S/C23H20F7N5/c1-22(2,23(28,29)30)9-8-13-4-3-5-17(19(13)27)34(11-18(25)26)20-15-10-14(24)6-7-16(15)35-12-31-33-21(35)32-20/h3-7,10,12,18H,8-9,11H2,1-2H3 |
| InChIKey | MXHQVHPOLCLWHT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |