C22H19F2N5 — CID 156536333
N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-6,7-difluoro-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine (PubChem CID 156536333) has the molecular formula C22H19F2N5 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-6,7-difluoro-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine.
| Compound Name | N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-6,7-difluoro-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
|---|---|
| PubChem CID | 156536333 |
| Molecular Formula | C22H19F2N5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | N-[3-(3,3-dimethylbut-1-ynyl)phenyl]-6,7-difluoro-N-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-amine |
| SMILES | CN(c1cccc(C#CC(C)(C)C)c1)c1nc2nncn2c2ccc(F)c(F)c12 |
| InChI | InChI=1S/C22H19F2N5/c1-22(2,3)11-10-14-6-5-7-15(12-14)28(4)20-18-17(9-8-16(23)19(18)24)29-13-25-27-21(29)26-20/h5-9,12-13H,1-4H3 |
| InChIKey | PUSJTRMFPQQXRY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|