C22H16FNO3S — CID 156538238
2-[4-(3-ethoxyphenyl)thiophen-2-yl]-6-fluoroquinoline-4-carboxylic acid (PubChem CID 156538238) has the molecular formula C22H16FNO3S and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[4-(3-ethoxyphenyl)thiophen-2-yl]-6-fluoroquinoline-4-carboxylic acid.
| Compound Name | 2-[4-(3-ethoxyphenyl)thiophen-2-yl]-6-fluoroquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 156538238 |
| Molecular Formula | C22H16FNO3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-[4-(3-ethoxyphenyl)thiophen-2-yl]-6-fluoroquinoline-4-carboxylic acid |
| SMILES | CCOc1cccc(-c2csc(-c3cc(C(=O)O)c4cc(F)ccc4n3)c2)c1 |
| InChI | InChI=1S/C22H16FNO3S/c1-2-27-16-5-3-4-13(8-16)14-9-21(28-12-14)20-11-18(22(25)26)17-10-15(23)6-7-19(17)24-20/h3-12H,2H2,1H3,(H,25,26) |
| InChIKey | QJPGBSSLGZIJSJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |