C18H21ClF3N5O2 — CID 156539546
(3R)-11-chloro-N-(2,2-dimethyloxan-4-yl)-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156539546) has the molecular formula C18H21ClF3N5O2 and a molecular weight of 431.85 g/mol. Its IUPAC name is (3R)-11-chloro-N-(2,2-dimethyloxan-4-yl)-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | (3R)-11-chloro-N-(2,2-dimethyloxan-4-yl)-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156539546 |
| Molecular Formula | C18H21ClF3N5O2 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (3R)-11-chloro-N-(2,2-dimethyloxan-4-yl)-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C)CC(NC(=O)N2C[C@@](C)(C(F)(F)F)c3c2cnc2cc(Cl)nn32)CCO1 |
| InChI | InChI=1S/C18H21ClF3N5O2/c1-16(2)7-10(4-5-29-16)24-15(28)26-9-17(3,18(20,21)22)14-11(26)8-23-13-6-12(19)25-27(13)14/h6,8,10H,4-5,7,9H2,1-3H3,(H,24,28)/t10?,17-/m1/s1 |
| InChIKey | KSVBSYXZMMSOTQ-NPMYUJNRSA-N |
| XLogP | 3.69 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |