C17H11ClF6N6O — CID 156539762
11-chloro-N-[2-(difluoromethyl)-6-fluoro-4-pyridinyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156539762) has the molecular formula C17H11ClF6N6O and a molecular weight of 464.76 g/mol. Its IUPAC name is 11-chloro-N-[2-(difluoromethyl)-6-fluoro-4-pyridinyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 11-chloro-N-[2-(difluoromethyl)-6-fluoro-4-pyridinyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156539762 |
| Molecular Formula | C17H11ClF6N6O |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 11-chloro-N-[2-(difluoromethyl)-6-fluoro-4-pyridinyl]-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C(F)(F)F)CN(C(=O)Nc2cc(F)nc(C(F)F)c2)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C17H11ClF6N6O/c1-16(17(22,23)24)6-29(9-5-25-12-4-10(18)28-30(12)13(9)16)15(31)26-7-2-8(14(20)21)27-11(19)3-7/h2-5,14H,6H2,1H3,(H,26,27,31) |
| InChIKey | AGQNWIGRVMHVRA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|