C22H17ClF5N7O2 — CID 156803159
(3R)-11-chloro-N-[2-(difluoromethyl)-6-(1-methylazetidin-3-yl)oxy-4-pyridinyl]-3-ethynyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 156803159) has the molecular formula C22H17ClF5N7O2 and a molecular weight of 541.87 g/mol. Its IUPAC name is (3R)-11-chloro-N-[2-(difluoromethyl)-6-(1-methylazetidin-3-yl)oxy-4-pyridinyl]-3-ethynyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | (3R)-11-chloro-N-[2-(difluoromethyl)-6-(1-methylazetidin-3-yl)oxy-4-pyridinyl]-3-ethynyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 156803159 |
| Molecular Formula | C22H17ClF5N7O2 |
| Molecular Weight | 541.87 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | (3R)-11-chloro-N-[2-(difluoromethyl)-6-(1-methylazetidin-3-yl)oxy-4-pyridinyl]-3-ethynyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | C#C[C@@]1(C(F)(F)F)CN(C(=O)Nc2cc(OC3CN(C)C3)nc(C(F)F)c2)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C22H17ClF5N7O2/c1-3-21(22(26,27)28)10-34(14-7-29-16-6-15(23)32-35(16)18(14)21)20(36)30-11-4-13(19(24)25)31-17(5-11)37-12-8-33(2)9-12/h1,4-7,12,19H,8-10H2,2H3,(H,30,31,36)/t21-/m1/s1 |
| InChIKey | JEQCHODGDHPBOM-OAQYLSRUSA-N |
| XLogP | 3.89 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.87 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|