C17H17F3N2O2 — CID 156541318
methyl 2-[4-[6-amino-3-(trifluoromethyl)-2-pyridinyl]phenyl]-2-methylpropanoate (PubChem CID 156541318) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is methyl 2-[4-[6-amino-3-(trifluoromethyl)-2-pyridinyl]phenyl]-2-methylpropanoate.
| Compound Name | methyl 2-[4-[6-amino-3-(trifluoromethyl)-2-pyridinyl]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 156541318 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | methyl 2-[4-[6-amino-3-(trifluoromethyl)-2-pyridinyl]phenyl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)c1ccc(-c2nc(N)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-16(2,15(23)24-3)11-6-4-10(5-7-11)14-12(17(18,19)20)8-9-13(21)22-14/h4-9H,1-3H3,(H2,21,22) |
| InChIKey | FWKJJZANNYGSJE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |