C11H9BrClN3O2 — CID 156542673
(2S)-5-(5-bromo-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carbaldehyde (PubChem CID 156542673) has the molecular formula C11H9BrClN3O2 and a molecular weight of 330.57 g/mol. Its IUPAC name is (2S)-5-(5-bromo-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carbaldehyde.
| Compound Name | (2S)-5-(5-bromo-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 156542673 |
| Molecular Formula | C11H9BrClN3O2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | (2S)-5-(5-bromo-4-chloropyrrolo[2,3-d]pyrimidin-7-yl)oxolane-2-carbaldehyde |
| SMILES | O=C[C@@H]1CCC(n2cc(Br)c3c(Cl)ncnc32)O1 |
| InChI | InChI=1S/C11H9BrClN3O2/c12-7-3-16(8-2-1-6(4-17)18-8)11-9(7)10(13)14-5-15-11/h3-6,8H,1-2H2/t6-,8?/m0/s1 |
| InChIKey | RUCXBPGPAOODPL-UUEFVBAFSA-N |
| XLogP | 2.72 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|