C24H27N3O2 — CID 156547102
4-(benzylamino)-N-cyclopropyl-7-methoxy-6-propan-2-ylquinoline-3-carboxamide (PubChem CID 156547102) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(benzylamino)-N-cyclopropyl-7-methoxy-6-propan-2-ylquinoline-3-carboxamide.
| Compound Name | 4-(benzylamino)-N-cyclopropyl-7-methoxy-6-propan-2-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 156547102 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-(benzylamino)-N-cyclopropyl-7-methoxy-6-propan-2-ylquinoline-3-carboxamide |
| SMILES | COc1cc2ncc(C(=O)NC3CC3)c(NCc3ccccc3)c2cc1C(C)C |
| InChI | InChI=1S/C24H27N3O2/c1-15(2)18-11-19-21(12-22(18)29-3)25-14-20(24(28)27-17-9-10-17)23(19)26-13-16-7-5-4-6-8-16/h4-8,11-12,14-15,17H,9-10,13H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | DMKXCYVISVMFGY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |