C32H31F4NO3 — CID 156547338
2-[3-fluoro-4-(4-nonoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid (PubChem CID 156547338) has the molecular formula C32H31F4NO3 and a molecular weight of 553.60 g/mol. Its IUPAC name is 2-[3-fluoro-4-(4-nonoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid.
| Compound Name | 2-[3-fluoro-4-(4-nonoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 156547338 |
| Molecular Formula | C32H31F4NO3 |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-[3-fluoro-4-(4-nonoxyphenyl)phenyl]-6-(trifluoromethyl)quinoline-4-carboxylic acid |
| SMILES | CCCCCCCCCOc1ccc(-c2ccc(-c3cc(C(=O)O)c4cc(C(F)(F)F)ccc4n3)cc2F)cc1 |
| InChI | InChI=1S/C32H31F4NO3/c1-2-3-4-5-6-7-8-17-40-24-13-9-21(10-14-24)25-15-11-22(18-28(25)33)30-20-27(31(38)39)26-19-23(32(34,35)36)12-16-29(26)37-30/h9-16,18-20H,2-8,17H2,1H3,(H,38,39) |
| InChIKey | UWTRMWRRJCGUNU-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|