C23H18N6O2 — CID 15654741
2-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid (PubChem CID 15654741) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid.
| Compound Name | 2-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 15654741 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-methyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C23H18N6O2/c1-14-24-20-8-4-7-19(23(30)31)21(20)29(14)13-15-9-11-16(12-10-15)17-5-2-3-6-18(17)22-25-27-28-26-22/h2-12H,13H2,1H3,(H,30,31)(H,25,26,27,28) |
| InChIKey | XDMNPPPPUHTYLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |