C18H19N5O — CID 15654858
6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzodiazepine-11-carbaldehyde (PubChem CID 15654858) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzodiazepine-11-carbaldehyde.
| Compound Name | 6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzodiazepine-11-carbaldehyde |
|---|---|
| PubChem CID | 15654858 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)pyrido[2,3-b][1,4]benzodiazepine-11-carbaldehyde |
| SMILES | CN1CCN(C2=Nc3cccnc3N(C=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C18H19N5O/c1-21-9-11-22(12-10-21)17-14-5-2-3-7-16(14)23(13-24)18-15(20-17)6-4-8-19-18/h2-8,13H,9-12H2,1H3 |
| InChIKey | LCBGLYREBZKLKZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|