C18H15F4N3O2 — CID 156549964
(E)-3-[4-fluoro-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enoic acid (PubChem CID 156549964) has the molecular formula C18H15F4N3O2 and a molecular weight of 381.33 g/mol. Its IUPAC name is (E)-3-[4-fluoro-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-fluoro-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156549964 |
| Molecular Formula | C18H15F4N3O2 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (E)-3-[4-fluoro-3-[2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]phenyl]prop-2-enoic acid |
| SMILES | C[C@H]1CCN1c1nc(-c2cc(/C=C/C(=O)O)ccc2F)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H15F4N3O2/c1-10-6-7-25(10)17-23-14(9-15(24-17)18(20,21)22)12-8-11(2-4-13(12)19)3-5-16(26)27/h2-5,8-10H,6-7H2,1H3,(H,26,27)/b5-3+/t10-/m0/s1 |
| InChIKey | WOQXUUIFMPBPPK-GFAPAMAISA-N |
| XLogP | 4.00 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|