C18H36N2 — CID 156551481
(3R)-3-[(4-tert-butylpiperidin-1-yl)methyl]-1-propan-2-ylpiperidine (PubChem CID 156551481) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is (3R)-3-[(4-tert-butylpiperidin-1-yl)methyl]-1-propan-2-ylpiperidine.
| Compound Name | (3R)-3-[(4-tert-butylpiperidin-1-yl)methyl]-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 156551481 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | (3R)-3-[(4-tert-butylpiperidin-1-yl)methyl]-1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCC[C@H](CN2CCC(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C18H36N2/c1-15(2)20-10-6-7-16(14-20)13-19-11-8-17(9-12-19)18(3,4)5/h15-17H,6-14H2,1-5H3/t16-/m1/s1 |
| InChIKey | HSMCDPGFQYGRHA-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |