C19H32N4O2 — CID 156552017
6-[3-[(2-ethoxycycloheptyl)oxymethyl]piperidin-1-yl]pyrazin-2-amine (PubChem CID 156552017) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6-[3-[(2-ethoxycycloheptyl)oxymethyl]piperidin-1-yl]pyrazin-2-amine.
| Compound Name | 6-[3-[(2-ethoxycycloheptyl)oxymethyl]piperidin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 156552017 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 6-[3-[(2-ethoxycycloheptyl)oxymethyl]piperidin-1-yl]pyrazin-2-amine |
| SMILES | CCOC1CCCCCC1OCC1CCCN(c2cncc(N)n2)C1 |
| InChI | InChI=1S/C19H32N4O2/c1-2-24-16-8-4-3-5-9-17(16)25-14-15-7-6-10-23(13-15)19-12-21-11-18(20)22-19/h11-12,15-17H,2-10,13-14H2,1H3,(H2,20,22) |
| InChIKey | DEVZORYSPAVVQP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |