C19H28O4 — CID 15655710
diethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-[(3E)-hexa-3,5-dienyl]propanedioate (PubChem CID 15655710) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is diethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-[(3E)-hexa-3,5-dienyl]propanedioate.
| Compound Name | diethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-[(3E)-hexa-3,5-dienyl]propanedioate |
|---|---|
| PubChem CID | 15655710 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | diethyl 2-[(2E,4E)-hexa-2,4-dienyl]-2-[(3E)-hexa-3,5-dienyl]propanedioate |
| SMILES | C=C/C=C/CCC(C/C=C/C=C/C)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C19H28O4/c1-5-9-11-13-15-19(17(20)22-7-3,18(21)23-8-4)16-14-12-10-6-2/h5-6,9-12,14H,1,7-8,13,15-16H2,2-4H3/b10-6+,11-9+,14-12+ |
| InChIKey | NSVLWYCDUAFHQR-YGRLAQRKSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|