C22H31BrN2O3 — CID 156558844
(11R)-15-bromo-4-(cyclopropylmethyl)-5,9,17-trimethyl-12-oxa-4,9-diazatetracyclo[9.7.0.01,6.013,18]octadeca-13(18),14,16-triene-6,14-diol (PubChem CID 156558844) has the molecular formula C22H31BrN2O3 and a molecular weight of 451.41 g/mol. Its IUPAC name is (11R)-15-bromo-4-(cyclopropylmethyl)-5,9,17-trimethyl-12-oxa-4,9-diazatetracyclo[9.7.0.01,6.013,18]octadeca-13(18),14,16-triene-6,14-diol.
| Compound Name | (11R)-15-bromo-4-(cyclopropylmethyl)-5,9,17-trimethyl-12-oxa-4,9-diazatetracyclo[9.7.0.01,6.013,18]octadeca-13(18),14,16-triene-6,14-diol |
|---|---|
| PubChem CID | 156558844 |
| Molecular Formula | C22H31BrN2O3 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (11R)-15-bromo-4-(cyclopropylmethyl)-5,9,17-trimethyl-12-oxa-4,9-diazatetracyclo[9.7.0.01,6.013,18]octadeca-13(18),14,16-triene-6,14-diol |
| SMILES | Cc1cc(Br)c(O)c2c1C13CCN(CC4CC4)C(C)C1(O)CCN(C)C[C@@H]3O2 |
| InChI | InChI=1S/C22H31BrN2O3/c1-13-10-16(23)19(26)20-18(13)21-6-9-25(11-15-4-5-15)14(2)22(21,27)7-8-24(3)12-17(21)28-20/h10,14-15,17,26-27H,4-9,11-12H2,1-3H3/t14?,17-,21?,22?/m0/s1 |
| InChIKey | KVPXXJFBVNLPSG-JJOZLZJHSA-N |
| XLogP | 3.03 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |