C29H36N2O5 — CID 71197576
benzyl N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-4,12-dimethyl-2,4,5,6,7,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]carbamate (PubChem CID 71197576) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is benzyl N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-4,12-dimethyl-2,4,5,6,7,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]carbamate.
| Compound Name | benzyl N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-4,12-dimethyl-2,4,5,6,7,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]carbamate |
|---|---|
| PubChem CID | 71197576 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | benzyl N-[(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-4,12-dimethyl-2,4,5,6,7,7a-hexahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]carbamate |
| SMILES | Cc1ccc(O)c2c1[C@]13CCN(CC4CC4)[C@H](C)[C@]1(O)CC[C@@H](NC(=O)OCc1ccccc1)[C@@H]3O2 |
| InChI | InChI=1S/C29H36N2O5/c1-18-8-11-23(32)25-24(18)28-14-15-31(16-20-9-10-20)19(2)29(28,34)13-12-22(26(28)36-25)30-27(33)35-17-21-6-4-3-5-7-21/h3-8,11,19-20,22,26,32,34H,9-10,12-17H2,1-2H3,(H,30,33)/t19-,22-,26+,28+,29-/m1/s1 |
| InChIKey | FTMQVVIYCKXBNR-FZYDWYOPSA-N |
| XLogP | 4.02 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |